C23H27Cl2N2O2+ — CID 143173977
[4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-methyl-(oxan-4-yl)azanium (PubChem CID 143173977) has the molecular formula C23H27Cl2N2O2+ and a molecular weight of 434.39 g/mol. Its IUPAC name is [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-methyl-(oxan-4-yl)azanium.
| Compound Name | [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-methyl-(oxan-4-yl)azanium |
|---|---|
| PubChem CID | 143173977 |
| Molecular Formula | C23H27Cl2N2O2+ |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-methyl-(oxan-4-yl)azanium |
| SMILES | C[NH+](Cc1ccc(CNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C23H26Cl2N2O2/c1-27(20-10-12-29-13-11-20)16-19-4-2-18(3-5-19)15-26-23(28)9-7-17-6-8-21(24)22(25)14-17/h2-9,14,20H,10-13,15-16H2,1H3,(H,26,28)/p+1/b9-7+ |
| InChIKey | AJXWMXJQHKBACJ-VQHVLOKHSA-O |
| XLogP | 3.52 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|