C24H29Cl2N2O2+ — CID 25267736
[4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium (PubChem CID 25267736) has the molecular formula C24H29Cl2N2O2+ and a molecular weight of 448.41 g/mol. Its IUPAC name is [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium.
| Compound Name | [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
|---|---|
| PubChem CID | 25267736 |
| Molecular Formula | C24H29Cl2N2O2+ |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-[[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]methyl]phenyl]methyl-dimethyl-(oxan-4-yl)azanium |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C24H28Cl2N2O2/c1-28(2,21-11-13-30-14-12-21)17-20-5-3-19(4-6-20)16-27-24(29)10-8-18-7-9-22(25)23(26)15-18/h3-10,15,21H,11-14,16-17H2,1-2H3/p+1/b10-8+ |
| InChIKey | KPMURJFGVZMWGQ-CSKARUKUSA-O |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|