C26H20Cl2N2OS — CID 108761232
(E)-3-(3,4-dichlorophenyl)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]prop-2-enamide (PubChem CID 108761232) has the molecular formula C26H20Cl2N2OS and a molecular weight of 479.43 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 108761232 |
| Molecular Formula | C26H20Cl2N2OS |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2csc(-c3ccc(CNC(=O)/C=C/c4ccc(Cl)c(Cl)c4)cc3)n2)cc1 |
| InChI | InChI=1S/C26H20Cl2N2OS/c1-17-2-8-20(9-3-17)24-16-32-26(30-24)21-10-4-19(5-11-21)15-29-25(31)13-7-18-6-12-22(27)23(28)14-18/h2-14,16H,15H2,1H3,(H,29,31)/b13-7+ |
| InChIKey | HQIVYOWEAPRQMF-NTUHNPAUSA-N |
| XLogP | 7.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|