C29H26N2O4S — CID 108761235
[2-methoxy-4-[(E)-3-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methylamino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 108761235) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methylamino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methylamino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 108761235 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [2-methoxy-4-[(E)-3-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methylamino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccc(-c3nc(-c4ccc(C)cc4)cs3)cc2)ccc1OC(C)=O |
| InChI | InChI=1S/C29H26N2O4S/c1-19-4-10-23(11-5-19)25-18-36-29(31-25)24-12-6-22(7-13-24)17-30-28(33)15-9-21-8-14-26(35-20(2)32)27(16-21)34-3/h4-16,18H,17H2,1-3H3,(H,30,33)/b15-9+ |
| InChIKey | BKAMZCIAPNGAIV-OQLLNIDSSA-N |
| XLogP | 6.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|