C27H23FN2O3S — CID 108749601
(E)-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 108749601) has the molecular formula C27H23FN2O3S and a molecular weight of 474.56 g/mol. Its IUPAC name is (E)-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108749601 |
| Molecular Formula | C27H23FN2O3S |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (E)-N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(-c2csc(-c3ccc(CNC(=O)/C=C/c4ccc(F)cc4)cc3)n2)cc1OC |
| InChI | InChI=1S/C27H23FN2O3S/c1-32-24-13-10-21(15-25(24)33-2)23-17-34-27(30-23)20-8-3-19(4-9-20)16-29-26(31)14-7-18-5-11-22(28)12-6-18/h3-15,17H,16H2,1-2H3,(H,29,31)/b14-7+ |
| InChIKey | WBKSWAQBPFIFPO-VGOFMYFVSA-N |
| XLogP | 5.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|