C21H18FNO4S — CID 7966259
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 7966259) has the molecular formula C21H18FNO4S and a molecular weight of 399.44 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7966259 |
| Molecular Formula | C21H18FNO4S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCc2csc(-c3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C21H18FNO4S/c1-25-18-9-3-14(11-19(18)26-2)4-10-20(24)27-12-17-13-28-21(23-17)15-5-7-16(22)8-6-15/h3-11,13H,12H2,1-2H3/b10-4+ |
| InChIKey | SJGWGWZGGGUIAK-ONNFQVAWSA-N |
| XLogP | 4.72 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|