C19H15F2NO5S — CID 32738933
[2-(furan-2-yl)-1,3-thiazol-4-yl]methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 32738933) has the molecular formula C19H15F2NO5S and a molecular weight of 407.39 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 32738933 |
| Molecular Formula | C19H15F2NO5S |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [2-(furan-2-yl)-1,3-thiazol-4-yl]methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2csc(-c3ccco3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H15F2NO5S/c1-24-16-9-12(4-6-14(16)27-19(20)21)5-7-17(23)26-10-13-11-28-18(22-13)15-3-2-8-25-15/h2-9,11,19H,10H2,1H3/b7-5+ |
| InChIKey | ANZJZYLWFYVKGT-FNORWQNLSA-N |
| XLogP | 4.77 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|