C22H20ClNO5S — CID 41070520
[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 41070520) has the molecular formula C22H20ClNO5S and a molecular weight of 445.92 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41070520 |
| Molecular Formula | C22H20ClNO5S |
| Molecular Weight | 445.92 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(-c2nc(COC(=O)/C=C/c3cc(Cl)c(OC)c(OC)c3)cs2)c1 |
| InChI | InChI=1S/C22H20ClNO5S/c1-26-17-6-4-5-15(11-17)22-24-16(13-30-22)12-29-20(25)8-7-14-9-18(23)21(28-3)19(10-14)27-2/h4-11,13H,12H2,1-3H3/b8-7+ |
| InChIKey | OGJNSGKMJKVPNS-BQYQJAHWSA-N |
| XLogP | 5.25 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.92 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|