C24H25NO7S — CID 31983717
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 31983717) has the molecular formula C24H25NO7S and a molecular weight of 471.53 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 31983717 |
| Molecular Formula | C24H25NO7S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OCc1csc(-c2cccc(OC)c2OC)n1 |
| InChI | InChI=1S/C24H25NO7S/c1-27-18-8-6-7-17(23(18)31-5)24-25-16(14-33-24)13-32-22(26)10-9-15-11-20(29-3)21(30-4)12-19(15)28-2/h6-12,14H,13H2,1-5H3/b10-9+ |
| InChIKey | TYQKVDUVTYYYHA-MDZDMXLPSA-N |
| XLogP | 4.61 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|