C20H18N2O5S — CID 30799981
[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-carbamoylbenzoate (PubChem CID 30799981) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-carbamoylbenzoate.
| Compound Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-carbamoylbenzoate |
|---|---|
| PubChem CID | 30799981 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methyl 4-carbamoylbenzoate |
| SMILES | COc1cccc(-c2nc(COC(=O)c3ccc(C(N)=O)cc3)cs2)c1OC |
| InChI | InChI=1S/C20H18N2O5S/c1-25-16-5-3-4-15(17(16)26-2)19-22-14(11-28-19)10-27-20(24)13-8-6-12(7-9-13)18(21)23/h3-9,11H,10H2,1-2H3,(H2,21,23) |
| InChIKey | IMUJLBUMFUUQBS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |