C18H14BrNO3S — CID 16539995
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-bromobenzoate (PubChem CID 16539995) has the molecular formula C18H14BrNO3S and a molecular weight of 404.29 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-bromobenzoate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 16539995 |
| Molecular Formula | C18H14BrNO3S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 4-bromobenzoate |
| SMILES | COc1ccccc1-c1nc(COC(=O)c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C18H14BrNO3S/c1-22-16-5-3-2-4-15(16)17-20-14(11-24-17)10-23-18(21)12-6-8-13(19)9-7-12/h2-9,11H,10H2,1H3 |
| InChIKey | ISZMGGYEQOMMOX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |