C19H17NO4S — CID 51173434
methyl 4-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]benzoate (PubChem CID 51173434) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl 4-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 51173434 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | methyl 4-[[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCc2csc(-c3ccccc3OC)n2)cc1 |
| InChI | InChI=1S/C19H17NO4S/c1-22-17-6-4-3-5-16(17)18-20-14(12-25-18)11-24-15-9-7-13(8-10-15)19(21)23-2/h3-10,12H,11H2,1-2H3 |
| InChIKey | WMWLJJVELQQGOF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |