C20H19NO4S — CID 16523884
[2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-ethoxybenzoate (PubChem CID 16523884) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-ethoxybenzoate.
| Compound Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-ethoxybenzoate |
|---|---|
| PubChem CID | 16523884 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(2-methoxyphenyl)-1,3-thiazol-4-yl]methyl 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCc1csc(-c2ccccc2OC)n1 |
| InChI | InChI=1S/C20H19NO4S/c1-3-24-18-11-7-5-9-16(18)20(22)25-12-14-13-26-19(21-14)15-8-4-6-10-17(15)23-2/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | YUVIFIOSGCYYOR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |