C20H18N2O6S — CID 8666399
(2-phenyl-1,3-thiazol-4-yl)methyl 5-ethoxy-4-methoxy-2-nitrobenzoate (PubChem CID 8666399) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 5-ethoxy-4-methoxy-2-nitrobenzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 5-ethoxy-4-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 8666399 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 5-ethoxy-4-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc(C(=O)OCc2csc(-c3ccccc3)n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H18N2O6S/c1-3-27-18-9-15(16(22(24)25)10-17(18)26-2)20(23)28-11-14-12-29-19(21-14)13-7-5-4-6-8-13/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | KZUIJRZQUDSOGN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|