C23H23N3O7S — CID 35484177
[2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate (PubChem CID 35484177) has the molecular formula C23H23N3O7S and a molecular weight of 485.52 g/mol. Its IUPAC name is [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate.
| Compound Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 35484177 |
| Molecular Formula | C23H23N3O7S |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 4-ethoxy-5-methoxy-2-nitrobenzoate |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)OCc2csc(CC(=O)Nc3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C23H23N3O7S/c1-4-32-20-10-18(26(29)30)17(9-19(20)31-3)23(28)33-12-16-13-34-22(25-16)11-21(27)24-15-7-5-14(2)6-8-15/h5-10,13H,4,11-12H2,1-3H3,(H,24,27) |
| InChIKey | DQVMNUQMQYRVFZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|