C24H24N2O5S — CID 33256257
[2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 3-methoxy-4-prop-2-enoxybenzoate (PubChem CID 33256257) has the molecular formula C24H24N2O5S and a molecular weight of 452.53 g/mol. Its IUPAC name is [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 3-methoxy-4-prop-2-enoxybenzoate.
| Compound Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 3-methoxy-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 33256257 |
| Molecular Formula | C24H24N2O5S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 3-methoxy-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCc2csc(CC(=O)Nc3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C24H24N2O5S/c1-4-11-30-20-10-7-17(12-21(20)29-3)24(28)31-14-19-15-32-23(26-19)13-22(27)25-18-8-5-16(2)6-9-18/h4-10,12,15H,1,11,13-14H2,2-3H3,(H,25,27) |
| InChIKey | KFLDZVPNAKEWDT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|