C18H20N2O3S — CID 18281840
[2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-pent-2-enoate (PubChem CID 18281840) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-pent-2-enoate.
| Compound Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-pent-2-enoate |
|---|---|
| PubChem CID | 18281840 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCc1csc(CC(=O)Nc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-4-5-18(22)23-11-15-12-24-17(20-15)10-16(21)19-14-8-6-13(2)7-9-14/h4-9,12H,3,10-11H2,1-2H3,(H,19,21)/b5-4+ |
| InChIKey | LBBOVDITCWDLPA-SNAWJCMRSA-N |
| XLogP | 3.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|