C23H19F3N2O3S — CID 29351346
[2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 29351346) has the molecular formula C23H19F3N2O3S and a molecular weight of 460.48 g/mol. Its IUPAC name is [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 29351346 |
| Molecular Formula | C23H19F3N2O3S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-[2-(4-methylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)Cc2nc(COC(=O)/C=C/c3ccc(C(F)(F)F)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H19F3N2O3S/c1-15-2-9-18(10-3-15)27-20(29)12-21-28-19(14-32-21)13-31-22(30)11-6-16-4-7-17(8-5-16)23(24,25)26/h2-11,14H,12-13H2,1H3,(H,27,29)/b11-6+ |
| InChIKey | DLPTYKLFFRTXQZ-IZZDOVSWSA-N |
| XLogP | 5.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|