C23H19F3N2O3S — CID 30823937
[2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 30823937) has the molecular formula C23H19F3N2O3S and a molecular weight of 460.48 g/mol. Its IUPAC name is [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 30823937 |
| Molecular Formula | C23H19F3N2O3S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [2-[2-(benzylamino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(Cc1nc(COC(=O)/C=C/c2ccc(C(F)(F)F)cc2)cs1)NCc1ccccc1 |
| InChI | InChI=1S/C23H19F3N2O3S/c24-23(25,26)18-9-6-16(7-10-18)8-11-22(30)31-14-19-15-32-21(28-19)12-20(29)27-13-17-4-2-1-3-5-17/h1-11,15H,12-14H2,(H,27,29)/b11-8+ |
| InChIKey | ZSBUMSZFWXTCFI-DHZHZOJOSA-N |
| XLogP | 4.78 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|