C18H12F3NO3 — CID 9457610
1,3-benzoxazol-2-ylmethyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 9457610) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9457610 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)OCc1nc2ccccc2o1 |
| InChI | InChI=1S/C18H12F3NO3/c19-18(20,21)13-8-5-12(6-9-13)7-10-17(23)24-11-16-22-14-3-1-2-4-15(14)25-16/h1-10H,11H2/b10-7+ |
| InChIKey | ZYMAYMPVTKEKPO-JXMROGBWSA-N |
| XLogP | 4.60 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|