C19H13F3N2O3 — CID 78538027
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 78538027) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 78538027 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)OCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H13F3N2O3/c20-19(21,22)15-8-4-5-13(11-15)9-10-17(25)26-12-16-23-24-18(27-16)14-6-2-1-3-7-14/h1-11H,12H2 |
| InChIKey | FATDLHYJZNTMAF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|