C18H15F3O5 — CID 7967729
methyl 2-methyl-5-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]oxymethyl]furan-3-carboxylate (PubChem CID 7967729) has the molecular formula C18H15F3O5 and a molecular weight of 368.31 g/mol. Its IUPAC name is methyl 2-methyl-5-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 7967729 |
| Molecular Formula | C18H15F3O5 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 2-methyl-5-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)/C=C/c2cccc(C(F)(F)F)c2)oc1C |
| InChI | InChI=1S/C18H15F3O5/c1-11-15(17(23)24-2)9-14(26-11)10-25-16(22)7-6-12-4-3-5-13(8-12)18(19,20)21/h3-9H,10H2,1-2H3/b7-6+ |
| InChIKey | HANDKUIPWCBNGB-VOTSOKGWSA-N |
| XLogP | 4.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|