C17H14Cl2O5 — CID 7995690
methyl 5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 7995690) has the molecular formula C17H14Cl2O5 and a molecular weight of 369.20 g/mol. Its IUPAC name is methyl 5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7995690 |
| Molecular Formula | C17H14Cl2O5 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | methyl 5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)oc1C |
| InChI | InChI=1S/C17H14Cl2O5/c1-10-13(17(21)22-2)8-12(24-10)9-23-16(20)6-4-11-3-5-14(18)15(19)7-11/h3-8H,9H2,1-2H3/b6-4+ |
| InChIKey | HTPMJERTBBKOEC-GQCTYLIASA-N |
| XLogP | 4.44 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|