C15H14ClNO7S — CID 7993888
methyl 5-[(2-chloro-5-sulfamoylbenzoyl)oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 7993888) has the molecular formula C15H14ClNO7S and a molecular weight of 387.80 g/mol. Its IUPAC name is methyl 5-[(2-chloro-5-sulfamoylbenzoyl)oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(2-chloro-5-sulfamoylbenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7993888 |
| Molecular Formula | C15H14ClNO7S |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | methyl 5-[(2-chloro-5-sulfamoylbenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2cc(S(N)(=O)=O)ccc2Cl)oc1C |
| InChI | InChI=1S/C15H14ClNO7S/c1-8-11(14(18)22-2)5-9(24-8)7-23-15(19)12-6-10(25(17,20)21)3-4-13(12)16/h3-6H,7H2,1-2H3,(H2,17,20,21) |
| InChIKey | CQDWZUYZVBBQAF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |