C15H13ClO5 — CID 2481052
methyl 5-[(4-chlorobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 2481052) has the molecular formula C15H13ClO5 and a molecular weight of 308.72 g/mol. Its IUPAC name is methyl 5-[(4-chlorobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(4-chlorobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 2481052 |
| Molecular Formula | C15H13ClO5 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | methyl 5-[(4-chlorobenzoyl)oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2ccc(Cl)cc2)oc1C |
| InChI | InChI=1S/C15H13ClO5/c1-9-13(15(18)19-2)7-12(21-9)8-20-14(17)10-3-5-11(16)6-4-10/h3-7H,8H2,1-2H3 |
| InChIKey | PBYRIWAEMSTUAY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |