C16H16O5 — CID 78767749
methyl 5-[(4-acetylphenoxy)methyl]-2-methylfuran-3-carboxylate (PubChem CID 78767749) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 5-[(4-acetylphenoxy)methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(4-acetylphenoxy)methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 78767749 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl 5-[(4-acetylphenoxy)methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COc2ccc(C(C)=O)cc2)oc1C |
| InChI | InChI=1S/C16H16O5/c1-10(17)12-4-6-13(7-5-12)20-9-14-8-15(11(2)21-14)16(18)19-3/h4-8H,9H2,1-3H3 |
| InChIKey | FEIOZEDGXUUNII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |