C17H16F3NO5 — CID 34481720
methyl 2-methyl-5-[[methyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]furan-3-carboxylate (PubChem CID 34481720) has the molecular formula C17H16F3NO5 and a molecular weight of 371.31 g/mol. Its IUPAC name is methyl 2-methyl-5-[[methyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[methyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 34481720 |
| Molecular Formula | C17H16F3NO5 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 2-methyl-5-[[methyl-[4-(trifluoromethoxy)benzoyl]amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(C)C(=O)c2ccc(OC(F)(F)F)cc2)oc1C |
| InChI | InChI=1S/C17H16F3NO5/c1-10-14(16(23)24-3)8-13(25-10)9-21(2)15(22)11-4-6-12(7-5-11)26-17(18,19)20/h4-8H,9H2,1-3H3 |
| InChIKey | RVNBICDCOJAJPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |