C16H14F3NO4 — CID 75383714
2-methyl-5-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]furan-3-carboxylic acid (PubChem CID 75383714) has the molecular formula C16H14F3NO4 and a molecular weight of 341.29 g/mol. Its IUPAC name is 2-methyl-5-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 75383714 |
| Molecular Formula | C16H14F3NO4 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-methyl-5-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CN(C)C(=O)c2ccc(C(F)(F)F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C16H14F3NO4/c1-9-13(15(22)23)7-12(24-9)8-20(2)14(21)10-3-5-11(6-4-10)16(17,18)19/h3-7H,8H2,1-2H3,(H,22,23) |
| InChIKey | KYORLJZRRFSWCY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |