C16H17NO4 — CID 119222158
2-methyl-5-[[methyl-(2-methylbenzoyl)amino]methyl]furan-3-carboxylic acid (PubChem CID 119222158) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-methyl-5-[[methyl-(2-methylbenzoyl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[methyl-(2-methylbenzoyl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119222158 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-methyl-5-[[methyl-(2-methylbenzoyl)amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1ccccc1C(=O)N(C)Cc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C16H17NO4/c1-10-6-4-5-7-13(10)15(18)17(3)9-12-8-14(16(19)20)11(2)21-12/h4-8H,9H2,1-3H3,(H,19,20) |
| InChIKey | ZOSHSTTYLPNMSH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |