C19H23NO5 — CID 119222646
2-methyl-5-[[methyl-[4-(2-methylphenoxy)butanoyl]amino]methyl]furan-3-carboxylic acid (PubChem CID 119222646) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-methyl-5-[[methyl-[4-(2-methylphenoxy)butanoyl]amino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[methyl-[4-(2-methylphenoxy)butanoyl]amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119222646 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-methyl-5-[[methyl-[4-(2-methylphenoxy)butanoyl]amino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1ccccc1OCCCC(=O)N(C)Cc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C19H23NO5/c1-13-7-4-5-8-17(13)24-10-6-9-18(21)20(3)12-15-11-16(19(22)23)14(2)25-15/h4-5,7-8,11H,6,9-10,12H2,1-3H3,(H,22,23) |
| InChIKey | DSXNGWCTBLOWDG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|