C14H21NO6 — CID 119222528
5-[[3-(2-methoxyethoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 119222528) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is 5-[[3-(2-methoxyethoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[[3-(2-methoxyethoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 119222528 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 5-[[3-(2-methoxyethoxy)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | COCCOCCC(=O)N(C)Cc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C14H21NO6/c1-10-12(14(17)18)8-11(21-10)9-15(2)13(16)4-5-20-7-6-19-3/h8H,4-7,9H2,1-3H3,(H,17,18) |
| InChIKey | UCVYORPKTFLFMC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|