C16H16FNO4 — CID 31711214
methyl 5-[[(2-fluorobenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 31711214) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is methyl 5-[[(2-fluorobenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[(2-fluorobenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 31711214 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 5-[[(2-fluorobenzoyl)-methylamino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(C)C(=O)c2ccccc2F)oc1C |
| InChI | InChI=1S/C16H16FNO4/c1-10-13(16(20)21-3)8-11(22-10)9-18(2)15(19)12-6-4-5-7-14(12)17/h4-8H,9H2,1-3H3 |
| InChIKey | QAUJKQXHTWDJEJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |