C16H13F3O6 — CID 2097734
methyl 2-methyl-5-[[4-(trifluoromethoxy)benzoyl]oxymethyl]furan-3-carboxylate (PubChem CID 2097734) has the molecular formula C16H13F3O6 and a molecular weight of 358.27 g/mol. Its IUPAC name is methyl 2-methyl-5-[[4-(trifluoromethoxy)benzoyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[4-(trifluoromethoxy)benzoyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 2097734 |
| Molecular Formula | C16H13F3O6 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | methyl 2-methyl-5-[[4-(trifluoromethoxy)benzoyl]oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2ccc(OC(F)(F)F)cc2)oc1C |
| InChI | InChI=1S/C16H13F3O6/c1-9-13(15(21)22-2)7-12(24-9)8-23-14(20)10-3-5-11(6-4-10)25-16(17,18)19/h3-7H,8H2,1-2H3 |
| InChIKey | CPQZUYISHOWIDM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |