C19H16O6 — CID 7812111
methyl 5-[(3-hydroxynaphthalene-2-carbonyl)oxymethyl]-2-methylfuran-3-carboxylate (PubChem CID 7812111) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is methyl 5-[(3-hydroxynaphthalene-2-carbonyl)oxymethyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[(3-hydroxynaphthalene-2-carbonyl)oxymethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7812111 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 5-[(3-hydroxynaphthalene-2-carbonyl)oxymethyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2cc3ccccc3cc2O)oc1C |
| InChI | InChI=1S/C19H16O6/c1-11-15(18(21)23-2)9-14(25-11)10-24-19(22)16-7-12-5-3-4-6-13(12)8-17(16)20/h3-9,20H,10H2,1-2H3 |
| InChIKey | NDXQUFLWEAUHKD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |