About (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate
(4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate (PubChem CID 7722921) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate |
| PubChem CID | 7722921 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2cc3ccccc3[nH]2)oc1C |
| InChI | InChI=1S/C17H15NO5/c1-10-13(16(19)21-2)8-12(23-10)9-22-17(20)15-7-11-5-3-4-6-14(11)18-15/h3-8,18H,9H2,1-2H3 |
| InChIKey | WMVAJGURUHQQBS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate?
The IUPAC name of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate (CID 7722921) is (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate.
What is the SMILES notation for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate?
The canonical SMILES for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate is COC(=O)c1cc(COC(=O)c2cc3ccccc3[nH]2)oc1C.
What is the InChIKey of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate?
The InChIKey is WMVAJGURUHQQBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5/c1-10-13(16(19)21-2)8-12(23-10)9-22-17(20)15-7-11-5-3-4-6-14(11)18-15/h3-8,18H,9H2,1-2H3.
What are the key properties of (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate?
(4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate has a molecular weight of 313.31 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 1H-indole-2-carboxylate is sourced from PubChem (CID 7722921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).