About butyl 1H-indole-2-carboxylate
butyl 1H-indole-2-carboxylate (PubChem CID 54052397) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is butyl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | butyl 1H-indole-2-carboxylate |
| PubChem CID | 54052397 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | butyl 1H-indole-2-carboxylate |
| SMILES | CCCCOC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-8-16-13(15)12-9-10-6-4-5-7-11(10)14-12/h4-7,9,14H,2-3,8H2,1H3 |
| InChIKey | LTVLBTUMIKLCEN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 1H-indole-2-carboxylate?
The IUPAC name of butyl 1H-indole-2-carboxylate (CID 54052397) is butyl 1H-indole-2-carboxylate.
What is the SMILES notation for butyl 1H-indole-2-carboxylate?
The canonical SMILES for butyl 1H-indole-2-carboxylate is CCCCOC(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of butyl 1H-indole-2-carboxylate?
The InChIKey is LTVLBTUMIKLCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-2-3-8-16-13(15)12-9-10-6-4-5-7-11(10)14-12/h4-7,9,14H,2-3,8H2,1H3.
What are the key properties of butyl 1H-indole-2-carboxylate?
butyl 1H-indole-2-carboxylate has a molecular weight of 217.27 g/mol, XLogP of 3.12, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 1H-indole-2-carboxylate is sourced from PubChem (CID 54052397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).