About 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride
2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride (PubChem CID 57340224) has the molecular formula C21H31ClN4O2
and a molecular weight of 406.96 g/mol. Its IUPAC name is 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride |
| PubChem CID | 57340224 |
| Molecular Formula | C21H31ClN4O2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCCN(N1CCCCC1)N1CCCCC1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H30N4O2.ClH/c26-21(20-17-18-9-3-4-10-19(18)22-20)27-16-15-25(23-11-5-1-6-12-23)24-13-7-2-8-14-24;/h3-4,9-10,17,22H,1-2,5-8,11-16H2;1H |
| InChIKey | IRZIQPLCDBTVAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride?
The IUPAC name of 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride (CID 57340224) is 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride.
What is the SMILES notation for 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride?
The canonical SMILES for 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride is Cl.O=C(OCCN(N1CCCCC1)N1CCCCC1)c1cc2ccccc2[nH]1.
What is the InChIKey of 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride?
The InChIKey is IRZIQPLCDBTVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O2.ClH/c26-21(20-17-18-9-3-4-10-19(18)22-20)27-16-15-25(23-11-5-1-6-12-23)24-13-7-2-8-14-24;/h3-4,9-10,17,22H,1-2,5-8,11-16H2;1H.
What are the key properties of 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride?
2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride has a molecular weight of 406.96 g/mol, XLogP of 3.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[di(piperidin-1-yl)amino]ethyl 1H-indole-2-carboxylate;hydrochloride is sourced from PubChem (CID 57340224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).