C18H15N3O4 — CID 7713498
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7713498) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7713498 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2[nH]1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O4/c22-16(20-21-17(23)12-6-2-1-3-7-12)11-25-18(24)15-10-13-8-4-5-9-14(13)19-15/h1-10,19H,11H2,(H,20,22)(H,21,23) |
| InChIKey | MEMDSPCTKYNPSB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|