C19H19N3O3 — CID 7723461
[2-[4-(dimethylamino)anilino]-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7723461) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7723461 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | CN(C)c1ccc(NC(=O)COC(=O)c2cc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-22(2)15-9-7-14(8-10-15)20-18(23)12-25-19(24)17-11-13-5-3-4-6-16(13)21-17/h3-11,21H,12H2,1-2H3,(H,20,23) |
| InChIKey | ZHZOCHTUCKYJNJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|