About ethane;ethyl 1H-indole-2-carboxylate
ethane;ethyl 1H-indole-2-carboxylate (PubChem CID 91376411) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is ethane;ethyl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl 1H-indole-2-carboxylate |
| PubChem CID | 91376411 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethane;ethyl 1H-indole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10;1-2/h3-7,12H,2H2,1H3;1-2H3 |
| InChIKey | NDEKCHUQJHOSTF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethyl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 1H-indole-2-carboxylate?
The IUPAC name of ethane;ethyl 1H-indole-2-carboxylate (CID 91376411) is ethane;ethyl 1H-indole-2-carboxylate.
What is the SMILES notation for ethane;ethyl 1H-indole-2-carboxylate?
The canonical SMILES for ethane;ethyl 1H-indole-2-carboxylate is CC.CCOC(=O)c1cc2ccccc2[nH]1.
What is the InChIKey of ethane;ethyl 1H-indole-2-carboxylate?
The InChIKey is NDEKCHUQJHOSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.C2H6/c1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10;1-2/h3-7,12H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethyl 1H-indole-2-carboxylate?
ethane;ethyl 1H-indole-2-carboxylate has a molecular weight of 219.28 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 1H-indole-2-carboxylate is sourced from PubChem (CID 91376411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).