C29H27NO2 — CID 174830027
ethyl 1H-indole-2-carboxylate;1,2,3,4-tetrahydrochrysene (PubChem CID 174830027) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl 1H-indole-2-carboxylate;1,2,3,4-tetrahydrochrysene.
| Compound Name | ethyl 1H-indole-2-carboxylate;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174830027 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | ethyl 1H-indole-2-carboxylate;1,2,3,4-tetrahydrochrysene |
| SMILES | CCOC(=O)c1cc2ccccc2[nH]1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C11H11NO2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-14-11(13)10-7-8-5-3-4-6-9(8)12-10/h1,3,5,7,9-12H,2,4,6,8H2;3-7,12H,2H2,1H3 |
| InChIKey | NYUWLFCQSWKDET-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|