C30H28 — CID 175241549
1,2-dimethylnaphthalene;1,2,3,4-tetrahydrochrysene (PubChem CID 175241549) has the molecular formula C30H28 and a molecular weight of 388.55 g/mol. Its IUPAC name is 1,2-dimethylnaphthalene;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,2-dimethylnaphthalene;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 175241549 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1,2-dimethylnaphthalene;1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1ccc2ccccc2c1C.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C12H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-9-7-8-11-5-3-4-6-12(11)10(9)2/h1,3,5,7,9-12H,2,4,6,8H2;3-8H,1-2H3 |
| InChIKey | JQERPKNVFFRTMJ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|