C22H27BrN2 — CID 174879452
piperazine;1,2,3,4-tetrahydrochrysene;hydrobromide (PubChem CID 174879452) has the molecular formula C22H27BrN2 and a molecular weight of 399.38 g/mol. Its IUPAC name is piperazine;1,2,3,4-tetrahydrochrysene;hydrobromide.
| Compound Name | piperazine;1,2,3,4-tetrahydrochrysene;hydrobromide |
|---|---|
| PubChem CID | 174879452 |
| Molecular Formula | C22H27BrN2 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | piperazine;1,2,3,4-tetrahydrochrysene;hydrobromide |
| SMILES | Br.C1CNCCN1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C4H10N2.BrH/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-6-4-3-5-1;/h1,3,5,7,9-12H,2,4,6,8H2;5-6H,1-4H2;1H |
| InChIKey | WEWGYUWGCDNVDC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|