C24H22 — CID 174248896
benzene;1,2,3,4-tetrahydrochrysene (PubChem CID 174248896) has the molecular formula C24H22 and a molecular weight of 310.44 g/mol. Its IUPAC name is benzene;1,2,3,4-tetrahydrochrysene.
| Compound Name | benzene;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174248896 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | benzene;1,2,3,4-tetrahydrochrysene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccccc1 |
| InChI | InChI=1S/C18H16.C6H6/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-6-5-3-1/h1,3,5,7,9-12H,2,4,6,8H2;1-6H |
| InChIKey | LJMPESSFNJXZSZ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|