C18H16Pd — CID 174462913
palladium;1,2,3,4-tetrahydrochrysene (PubChem CID 174462913) has the molecular formula C18H16Pd and a molecular weight of 338.75 g/mol. Its IUPAC name is palladium;1,2,3,4-tetrahydrochrysene.
| Compound Name | palladium;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174462913 |
| Molecular Formula | C18H16Pd |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | palladium;1,2,3,4-tetrahydrochrysene |
| SMILES | [Pd].c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.Pd/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;/h1,3,5,7,9-12H,2,4,6,8H2; |
| InChIKey | GHWAOKJUTMMSIK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|