C24H24S — CID 174759150
ethene;1,2,3,4-tetrahydrochrysene;thiophene (PubChem CID 174759150) has the molecular formula C24H24S and a molecular weight of 344.52 g/mol. Its IUPAC name is ethene;1,2,3,4-tetrahydrochrysene;thiophene.
| Compound Name | ethene;1,2,3,4-tetrahydrochrysene;thiophene |
|---|---|
| PubChem CID | 174759150 |
| Molecular Formula | C24H24S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethene;1,2,3,4-tetrahydrochrysene;thiophene |
| SMILES | C=C.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccsc1 |
| InChI | InChI=1S/C18H16.C4H4S.C2H4/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-5-3-1;1-2/h1,3,5,7,9-12H,2,4,6,8H2;1-4H;1-2H2 |
| InChIKey | XOXSZJSOAOYYAM-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|