C30H24O — CID 174838416
benzo[e][2]benzofuran;1,2,3,4-tetrahydrochrysene (PubChem CID 174838416) has the molecular formula C30H24O and a molecular weight of 400.52 g/mol. Its IUPAC name is benzo[e][2]benzofuran;1,2,3,4-tetrahydrochrysene.
| Compound Name | benzo[e][2]benzofuran;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174838416 |
| Molecular Formula | C30H24O |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | benzo[e][2]benzofuran;1,2,3,4-tetrahydrochrysene |
| SMILES | c1ccc2c(c1)ccc1c3c(ccc12)CCCC3.c1ccc2c(c1)ccc1cocc12 |
| InChI | InChI=1S/C18H16.C12H8O/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-11-9(3-1)5-6-10-7-13-8-12(10)11/h1,3,5,7,9-12H,2,4,6,8H2;1-8H |
| InChIKey | ZYOJVKGLJVBCTD-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|