C34H28O2 — CID 174595165
1,4-dimethylanthracene-9,10-dione;1,2,3,4-tetrahydrochrysene (PubChem CID 174595165) has the molecular formula C34H28O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1,4-dimethylanthracene-9,10-dione;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1,4-dimethylanthracene-9,10-dione;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174595165 |
| Molecular Formula | C34H28O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1,4-dimethylanthracene-9,10-dione;1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1ccc(C)c2c1C(=O)c1ccccc1C2=O.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C16H12O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-9-7-8-10(2)14-13(9)15(17)11-5-3-4-6-12(11)16(14)18/h1,3,5,7,9-12H,2,4,6,8H2;3-8H,1-2H3 |
| InChIKey | PVSQCSAXXJGCPX-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|