C24H22O2 — CID 174346612
6-methylpyran-2-one;1,2,3,4-tetrahydrochrysene (PubChem CID 174346612) has the molecular formula C24H22O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 6-methylpyran-2-one;1,2,3,4-tetrahydrochrysene.
| Compound Name | 6-methylpyran-2-one;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174346612 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 6-methylpyran-2-one;1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1cccc(=O)o1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C6H6O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-5-3-2-4-6(7)8-5/h1,3,5,7,9-12H,2,4,6,8H2;2-4H,1H3 |
| InChIKey | VRADTBXRVXLLQZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|