C28H28O2 — CID 174385552
6-pent-3-enylpyran-2-one;1,2,3,4-tetrahydrochrysene (PubChem CID 174385552) has the molecular formula C28H28O2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 6-pent-3-enylpyran-2-one;1,2,3,4-tetrahydrochrysene.
| Compound Name | 6-pent-3-enylpyran-2-one;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174385552 |
| Molecular Formula | C28H28O2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 6-pent-3-enylpyran-2-one;1,2,3,4-tetrahydrochrysene |
| SMILES | CC=CCCc1cccc(=O)o1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C10H12O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-3-4-6-9-7-5-8-10(11)12-9/h1,3,5,7,9-12H,2,4,6,8H2;2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | MHTYEWPPIMQGCW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|